![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | earl.it | 2018-01-02 16:00 | 4.8M | |
| remix.it | 2018-01-02 16:00 | 3.8M | |
| knifa's crack adventure.it | 2011-05-29 13:28 | 3.8M | |
| retire.it | 2018-01-02 16:00 | 3.1M | |
| jd.it | 2018-01-02 16:00 | 3.1M | |
| sixpack.it | 2018-01-02 16:01 | 3.0M | |
| milpitas.it | 2018-01-02 16:00 | 3.0M | |
| you call that a guitar.it | 2011-05-29 14:15 | 3.0M | |
| rice balls.it | 2018-01-02 16:00 | 3.0M | |
| glueberry.it | 2018-01-02 16:00 | 2.9M | |
| daycare.it | 2018-01-02 16:00 | 2.9M | |
| filled buns processing.it | 2018-01-02 16:00 | 2.8M | |
| joyrider.it | 2018-01-02 16:00 | 2.8M | |
| timber.it | 2018-01-02 16:01 | 2.7M | |
| nutstar.it | 2018-01-02 16:00 | 2.7M | |
| salted.it | 2018-01-02 16:00 | 2.7M | |
| high five.it | 2018-01-02 16:00 | 2.6M | |
| time ruler.it | 2018-01-02 16:01 | 2.6M | |
| name my dog.it | 2018-01-02 16:00 | 2.6M | |
| light rain.it | 2011-05-29 13:30 | 2.6M | |
| fluid balance.it | 2018-01-02 16:00 | 2.6M | |
| silent casks.it | 2018-01-02 16:01 | 2.5M | |
| mixxus the great.it | 2018-01-02 16:00 | 2.5M | |
| mayo party.it | 2018-01-02 16:00 | 2.5M | |
| reel to eel.it | 2018-01-02 16:00 | 2.4M | |
| gold.it | 2018-01-02 16:00 | 2.4M | |
| excess material.it | 2018-01-02 16:00 | 2.4M | |
| thin frank.it | 2018-01-02 16:01 | 2.4M | |
| brazil.it | 2018-01-02 16:00 | 2.4M | |
| higgins.it | 2018-01-02 16:00 | 2.4M | |
| inordered.it | 2018-01-02 16:00 | 2.3M | |
| quant.it | 2018-01-02 16:00 | 2.3M | |
| floon.it | 2018-01-02 16:00 | 2.3M | |
| gao generation.it | 2018-01-02 16:00 | 2.3M | |
| terraformation.it | 2018-01-02 16:01 | 2.3M | |
| updog.it | 2018-01-02 16:01 | 2.2M | |
| zeri.it | 2018-01-02 16:01 | 2.2M | |
| sidegoat.it | 2018-01-02 16:01 | 2.2M | |
| mysterious organ.it | 2011-05-29 13:37 | 2.2M | |
| bimpin.it | 2018-01-02 16:00 | 2.2M | |
| nullphonic.it | 2018-01-02 16:00 | 2.2M | |
| hue shift.it | 2018-01-02 16:00 | 2.1M | |
| disregarder.it | 2018-01-02 16:00 | 2.1M | |
| dick bokeh.it | 2011-05-29 13:06 | 2.1M | |
| sleep debt mgmt.it | 2018-01-02 16:01 | 2.1M | |
| akiba-dogg.it | 2018-01-02 16:00 | 2.1M | |
| kuri.it | 2018-01-02 16:00 | 2.0M | |
| so many.it | 2011-05-29 13:57 | 2.0M | |
| slice my destiny.it | 2018-01-02 16:01 | 2.0M | |
| intake.it | 2018-01-02 16:00 | 2.0M | |
| wheatbrain.it | 2018-01-02 16:01 | 2.0M | |
| cool, yo (paradise).it | 2011-05-29 13:03 | 2.0M | |
| sausagestory.it | 2018-01-02 16:00 | 2.0M | |
| scrunk.it | 2018-01-02 16:00 | 1.9M | |
| nonvege.it | 2011-05-29 13:39 | 1.9M | |
| video games.it | 2018-01-02 16:01 | 1.9M | |
| secret trance.it | 2011-05-29 13:50 | 1.9M | |
| sewer music.it | 2018-01-02 16:01 | 1.9M | |
| guack.it | 2018-01-02 16:00 | 1.9M | |
| floret.it | 2018-01-02 16:00 | 1.9M | |
| corned bouche.it | 2018-01-02 16:00 | 1.9M | |
| 2006.it | 2011-05-29 12:46 | 1.8M | |
| unwire.it | 2018-01-02 16:01 | 1.8M | |
| chalupa pass.it | 2018-01-02 16:00 | 1.8M | |
| guyphoto.it | 2018-01-02 16:00 | 1.7M | |
| revibe.it | 2018-01-02 16:00 | 1.7M | |
| butterfingers-chan.it | 2018-01-02 16:00 | 1.7M | |
| nikkouland.it | 2018-01-02 16:00 | 1.7M | |
| bald.it | 2018-01-02 16:00 | 1.7M | |
| social links.it | 2018-01-02 16:01 | 1.7M | |
| d. benist.it | 2018-01-02 16:00 | 1.6M | |
| i lernd a new skill 2day.it | 2011-05-29 13:24 | 1.6M | |
| slashies.it | 2018-01-02 16:01 | 1.6M | |
| raisin.it | 2018-01-02 16:00 | 1.6M | |
| talk to a snail.it | 2011-05-29 14:01 | 1.6M | |
| gumi.it | 2018-01-02 16:00 | 1.6M | |
| stacks on duck mod gang.it | 2018-01-02 16:01 | 1.5M | |
| bard.it | 2018-01-02 16:00 | 1.5M | |
| world of jake 'n jace(op).it | 2018-01-02 16:01 | 1.5M | |
| slowbee.it | 2018-01-02 16:01 | 1.5M | |
| sheldon.it | 2018-01-02 16:01 | 1.5M | |
| an ordinary ant.it | 2011-05-29 12:48 | 1.5M | |
| bag donus.it | 2018-01-02 16:00 | 1.4M | |
| scrapper.it | 2018-01-02 16:00 | 1.4M | |
| fanciful !! ponpon.it | 2011-05-29 13:15 | 1.4M | |
| stage9.it | 2018-01-02 16:01 | 1.3M | |
| duckfackin.it | 2011-05-29 13:12 | 1.3M | |
| littlepianist.it | 2018-01-02 16:00 | 1.3M | |
| black gates of eternity.it | 2011-05-29 12:54 | 1.3M | |
| shaturday.it | 2011-05-29 13:51 | 1.3M | |
| tossed salad.it | 2011-05-29 14:06 | 1.3M | |
| beluga.it | 2018-01-02 16:00 | 1.3M | |
| gaybert.it | 2011-05-29 13:19 | 1.3M | |
| simultaneous time penis.it | 2011-05-29 13:54 | 1.3M | |
| chappy.it | 2018-01-02 16:00 | 1.2M | |
| drive real fast.it | 2018-01-02 16:00 | 1.2M | |
| laserwash.it | 2018-01-02 16:00 | 1.2M | |
| sass.it | 2018-01-02 16:00 | 1.2M | |
| clbuttical.it | 2011-05-29 13:02 | 1.2M | |
| let's sync.it | 2018-01-02 16:00 | 1.2M | |
| myspats.it | 2018-01-02 16:00 | 1.2M | |
| fat pool.it | 2018-01-02 16:00 | 1.2M | |
| promenade (cover).it | 2011-05-29 13:44 | 1.2M | |
| groabe.it | 2018-01-02 16:00 | 1.2M | |
| pet fashion.it | 2011-05-29 13:42 | 1.1M | |
| altered silence.it | 2011-05-29 12:47 | 1.1M | |
| how to count.it | 2018-01-02 16:00 | 1.1M | |
| sacks.it | 2018-01-02 16:00 | 1.1M | |
| rubber munchers.it | 2011-05-29 13:47 | 1.1M | |
| innocent cogs.it | 2011-05-29 13:25 | 1.1M | |
| shambhala stomp.it | 2011-05-29 13:51 | 1.1M | |
| darklog.it | 2018-01-02 16:00 | 1.1M | |
| groast.it | 2018-01-02 16:00 | 1.0M | |
| the olive gang.it | 2018-01-02 16:01 | 1.0M | |
| haxus canyon.it | 2011-05-29 13:21 | 1.0M | |
| double dennis.it | 2011-05-29 13:10 | 1.0M | |
| crustie.it | 2011-05-29 13:04 | 1.0M | |
| brownstain.it | 2018-01-02 16:00 | 1.0M | |
| macaroni sigma.it | 2018-01-02 16:00 | 1.0M | |
| gambits.it | 2011-05-29 13:18 | 1.0M | |
| five idols.it | 2011-05-29 13:17 | 1.0M | |
| whee.it | 2011-05-29 14:11 | 1.0M | |
| slick substrings.it | 2011-05-29 13:55 | 1.0M | |
| progdog.it | 2018-01-02 16:00 | 1.0M | |
| reduz's toy factory.it | 2011-05-29 13:46 | 972K | |
| shadows.it | 2018-01-02 16:01 | 958K | |
| syncshot.it | 2018-01-02 16:01 | 958K | |
| puppeteer.it | 2018-01-02 16:00 | 933K | |
| malibu ducks.it | 2011-05-29 13:32 | 933K | |
| furbyburger.it | 2018-01-02 16:00 | 922K | |
| vanilla wafer.it | 2011-05-29 14:09 | 919K | |
| awoogah.it | 2011-05-29 12:51 | 912K | |
| doopy.it | 2011-05-29 13:10 | 909K | |
| munyu.it | 2018-01-02 16:00 | 903K | |
| iyasu.it | 2018-01-02 16:00 | 901K | |
| nodulez.it | 2018-01-02 16:00 | 899K | |
| gaggle.it | 2011-05-29 13:18 | 897K | |
| slapnuts 64.it | 2011-05-29 13:54 | 881K | |
| gas propeller.it | 2011-05-29 13:18 | 880K | |
| ccrapplefefeff (cfejifeffe).it | 2011-05-29 12:59 | 879K | |
| facebook.it | 2018-01-02 16:00 | 878K | |
| moltres.it | 2018-01-02 16:00 | 874K | |
| yestes.it | 2011-05-29 14:13 | 874K | |
| fancy brain.it | 2011-05-29 13:16 | 869K | |
| gregory.it | 2018-01-02 16:00 | 867K | |
| night expedition.it | 2009-11-01 17:12 | 866K | |
| miserati.it | 2011-05-29 13:35 | 863K | |
| tranz.it | 2011-05-29 14:07 | 858K | |
| dilly chuck.it | 2011-05-29 13:07 | 856K | |
| dinks.it | 2018-01-02 16:00 | 853K | |
| showers.it | 2011-05-29 13:52 | 852K | |
| hedgehog's salami.it | 2011-05-29 13:22 | 848K | |
| chops.it | 2011-05-29 13:00 | 847K | |
| slowda.it | 2018-01-02 16:01 | 830K | |
| odd land.it | 2011-05-29 13:39 | 826K | |
| nuttural.it | 2018-01-02 16:00 | 818K | |
| sashimi secretary.it | 2011-05-29 13:49 | 815K | |
| duckblaster.it | 2011-05-29 13:12 | 814K | |
| cave mushroom.it | 2011-05-29 12:59 | 812K | |
| grille.it | 2018-01-02 16:00 | 812K | |
| overbright.it | 2018-01-02 16:00 | 809K | |
| t.it | 2011-05-29 14:01 | 809K | |
| autumn.it | 2011-05-29 12:50 | 808K | |
| nutwalker.it | 2018-01-02 16:00 | 799K | |
| short circuit.it | 2011-05-29 13:52 | 798K | |
| oops i made this.it | 2011-05-29 13:40 | 798K | |
| harvest moon.it | 2010-05-16 13:53 | 797K | |
| pneumonopsychoparaphilic.it | 2011-05-29 13:43 | 793K | |
| makmak.it | 2018-01-02 16:00 | 785K | |
| doggers.it | 2011-05-29 13:09 | 784K | |
| jacky.it | 2018-01-02 16:00 | 783K | |
| dokidoki denpa virus.it | 2011-05-29 13:09 | 782K | |
| biohazard.it | 2011-05-29 12:53 | 775K | |
| buttin.it | 2018-01-02 16:00 | 775K | |
| spine focus.it | 2011-05-29 13:59 | 768K | |
| bobby bo bobbo.it | 2011-05-29 12:55 | 756K | |
| the penguin's lament.it | 2011-05-29 14:04 | 752K | |
| cheese alpha.it | 2011-05-29 12:59 | 752K | |
| prehistoric bird.it | 2011-05-29 13:43 | 748K | |
| makaha.it | 2011-05-29 13:32 | 746K | |
| smooth rolands.it | 2011-05-29 13:56 | 740K | |
| ghfugefeafz (prog).it | 2011-05-29 13:20 | 740K | |
| helpme pt. 2.it | 2011-05-29 13:22 | 739K | |
| weird hill.it | 2011-05-29 14:10 | 738K | |
| duckswinger.it | 2011-05-29 13:13 | 729K | |
| subway cheese tesselation.it | 2011-05-29 14:00 | 725K | |
| adventures of sir cliche.it | 2011-05-29 12:47 | 725K | |
| the pen-15 incident.it | 2011-05-29 14:03 | 724K | |
| lintfinger.it | 2018-01-02 16:00 | 722K | |
| pootis.it | 2018-01-02 16:00 | 720K | |
| mousedog.it | 2018-01-02 16:00 | 719K | |
| bullet octopus.it | 2011-05-29 12:57 | 718K | |
| ohyea.it | 2018-01-02 16:00 | 716K | |
| tried by 11.5.it | 2011-05-29 14:07 | 714K | |
| composition process.it | 2011-05-29 13:02 | 712K | |
| duck rag.it | 2011-05-29 13:11 | 712K | |
| duckromancer.it | 2018-01-02 16:00 | 706K | |
| dusty treasure.it | 2011-05-29 13:13 | 704K | |
| severe monster.it | 2011-05-29 13:51 | 704K | |
| selfy.it | 2011-05-29 13:50 | 703K | |
| my friend's house.it | 2018-01-02 16:00 | 702K | |
| mamoic.it | 2011-05-29 13:33 | 701K | |
| tempurate.it | 2011-05-29 14:02 | 698K | |
| peanut butter.it | 2011-05-29 13:42 | 698K | |
| junkyard jungle.it | 2011-05-29 13:26 | 697K | |
| lemongelon.it | 2011-05-29 13:29 | 693K | |
| no time for details.it | 2011-05-29 13:38 | 692K | |
| reticulum.it | 2011-05-29 13:47 | 685K | |
| supretz.it | 2018-01-02 16:01 | 685K | |
| secret bass and the roach.it | 2011-05-29 13:49 | 684K | |
| duckscooter.it | 2011-05-29 13:13 | 682K | |
| bjornholm.it | 2011-05-29 12:54 | 678K | |
| beansectors.it | 2011-05-29 12:52 | 678K | |
| pizzadog.it | 2011-05-29 13:43 | 676K | |
| doo.it | 2011-05-29 13:09 | 676K | |
| time warp.it | 2011-05-29 14:05 | 671K | |
| lee.it | 2018-01-02 16:00 | 668K | |
| lalalalalionbear.it | 2011-05-29 13:28 | 666K | |
| herpdongle.it | 2011-05-29 13:22 | 662K | |
| cannibal volcano.it | 2011-05-29 12:58 | 660K | |
| ding dong.it | 2011-05-29 13:07 | 659K | |
| garian tune your guitar.it | 2011-05-29 13:18 | 657K | |
| beanulous typography.it | 2011-05-29 12:53 | 652K | |
| currypatch.it | 2018-01-02 16:00 | 652K | |
| fail.it | 2011-05-29 13:14 | 645K | |
| complimentary cat.it | 2011-05-29 13:02 | 643K | |
| brandonizer.it | 2011-05-29 12:56 | 640K | |
| rush hour.it | 2011-05-29 13:47 | 640K | |
| overland journey.it | 2011-05-29 13:40 | 634K | |
| oonties.it | 2011-05-29 13:40 | 633K | |
| duck theorem.it | 2011-05-29 13:11 | 632K | |
| dials.it | 2011-05-29 13:05 | 628K | |
| haunted jungle village.it | 2011-05-29 13:21 | 628K | |
| weiss.it | 2011-05-29 14:10 | 626K | |
| warning- pingas.it | 2011-05-29 14:10 | 626K | |
| music.it | 2018-01-02 16:00 | 625K | |
| underclocking the genesis.it | 2011-05-29 14:08 | 623K | |
| chordheimer.it | 2011-05-29 13:01 | 618K | |
| papercuts.it | 2011-05-29 13:41 | 615K | |
| kakakaka.it | 2011-05-29 13:26 | 609K | |
| ballad of the onionking.it | 2011-05-29 12:52 | 608K | |
| marvelous.it | 2011-05-29 13:33 | 606K | |
| the pen.it | 2018-01-02 16:01 | 603K | |
| monsquest.it | 2018-01-02 16:00 | 600K | |
| southern sunset.it | 2011-05-29 13:57 | 598K | |
| sphynx tale.it | 2011-05-29 13:59 | 594K | |
| third nut.it | 2018-01-02 16:01 | 592K | |
| alien machine.it | 2011-05-29 12:47 | 588K | |
| jelaycats.it | 2018-01-02 16:00 | 588K | |
| accelerando at end.it | 2011-05-29 12:46 | 587K | |
| ramen gear.it | 2011-05-29 13:45 | 586K | |
| denisus.it | 2011-05-29 13:05 | 585K | |
| cinnamon.it | 2011-05-29 13:01 | 585K | |
| tastes like blue.it | 2011-05-29 14:01 | 584K | |
| roasted peanut.it | 2011-05-29 13:47 | 583K | |
| slugs realm.it | 2011-05-29 13:55 | 581K | |
| qualo stinks.it | 2011-05-29 13:45 | 580K | |
| randical.it | 2011-05-29 13:45 | 580K | |
| blammo!.it | 2011-05-29 12:54 | 579K | |
| the overlord.it | 2011-05-29 14:03 | 577K | |
| glutamation.it | 2011-05-29 13:20 | 575K | |
| honeycomb.it | 2011-05-29 13:23 | 573K | |
| #shrine mod.it | 2011-05-29 12:45 | 573K | |
| zen garden.it | 2011-05-29 14:15 | 573K | |
| shin.it | 2011-05-29 13:52 | 571K | |
| lubricated dolphins.it | 2011-05-29 13:31 | 570K | |
| sally the horse.it | 2011-05-29 13:48 | 568K | |
| dol.it | 2018-01-02 16:00 | 564K | |
| molex maneuver.it | 2011-05-29 13:35 | 561K | |
| set blaster=.it | 2011-05-29 13:51 | 560K | |
| meow can.it | 2011-05-29 13:34 | 560K | |
| axolotl.it | 2011-05-29 12:51 | 559K | |
| magic zipper.it | 2011-05-29 13:31 | 559K | |
| in a chinese motorboat (madfarts).it | 2011-05-29 13:24 | 557K | |
| dual runner.it | 2011-05-29 13:11 | 556K | |
| murduits.it | 2011-05-29 13:36 | 555K | |
| mr. goodbar.it | 2011-05-29 13:35 | 555K | |
| rent-a-nut.it | 2018-01-02 16:00 | 546K | |
| generic underwater theme.it | 2011-05-29 13:19 | 546K | |
| king tritone.it | 2011-05-29 13:27 | 541K | |
| hg (mercurial).it | 2011-05-29 13:22 | 535K | |
| i saw an egg.it | 2011-05-29 13:24 | 532K | |
| lldog.it | 2018-01-02 16:00 | 530K | |
| rats.it | 2011-05-29 13:45 | 520K | |
| milk rain.it | 2011-05-29 13:34 | 520K | |
| island of reduzio.it | 2011-05-29 13:26 | 517K | |
| firetruck.it | 2011-05-29 13:16 | 516K | |
| terminal meat.it | 2011-05-29 14:02 | 516K | |
| sultans of cheese.it | 2011-05-29 14:00 | 514K | |
| the formal party.it | 2011-05-29 14:03 | 512K | |
| flyed poteto.it | 2011-05-29 13:17 | 512K | |
| mutant bass.it | 2011-05-29 13:36 | 508K | |
| slow going.it | 2011-05-29 13:55 | 507K | |
| spinich.it | 2018-01-02 16:01 | 507K | |
| rabbit ruin.it | 2011-05-29 13:45 | 504K | |
| today is sunday.it | 2011-05-29 14:06 | 503K | |
| varadiation.it | 2011-05-29 14:09 | 500K | |
| xsalad.it | 2011-05-29 14:12 | 500K | |
| line 6khz.it | 2011-05-29 13:30 | 498K | |
| wiener process.it | 2011-05-29 14:11 | 496K | |
| banana conspiracy.it | 2011-05-29 12:52 | 495K | |
| nuthunters.it | 2018-01-02 16:00 | 488K | |
| sparkle beach.it | 2011-05-29 13:58 | 486K | |
| elbowdyne.it | 2011-05-29 13:14 | 485K | |
| refractive world.it | 2011-05-29 13:46 | 482K | |
| cannoli sigma.it | 2018-01-02 16:00 | 481K | |
| overture.it | 2011-05-29 13:40 | 481K | |
| porters.it | 2018-01-02 16:00 | 479K | |
| sinis.it | 2011-05-29 13:54 | 478K | |
| edo enterprise.it | 2011-05-29 13:13 | 475K | |
| blood moon.it | 2011-05-29 12:55 | 475K | |
| pattern density death pena.it | 2011-05-29 13:41 | 475K | |
| lateriser.it | 2018-01-02 16:00 | 473K | |
| the spam doctor.it | 2011-05-29 14:04 | 472K | |
| diurnal.it | 2011-05-29 13:08 | 471K | |
| applesauce tale.it | 2011-05-29 12:49 | 470K | |
| oysters.it | 2011-05-29 13:41 | 468K | |
| funky cheez.it | 2011-05-29 13:17 | 467K | |
| hjkl.it | 2011-05-29 13:23 | 464K | |
| spectrum.it | 2011-05-29 13:58 | 464K | |
| amanita man.it | 2011-05-29 12:48 | 463K | |
| donut counting.it | 2011-05-29 13:09 | 463K | |
| pieceroom.it | 2011-05-29 13:42 | 459K | |
| turned to stone.it | 2011-05-29 14:08 | 458K | |
| brain in a jar.it | 2011-05-29 12:56 | 456K | |
| mira enters uncharted terr.it | 2011-05-29 13:34 | 456K | |
| lamia.it | 2011-05-29 13:29 | 456K | |
| little groove.it | 2011-05-29 13:30 | 455K | |
| casiopea land.it | 2011-05-29 12:59 | 455K | |
| guns & sweat.it | 2011-05-29 13:21 | 451K | |
| detective meatbun.it | 2011-05-29 13:05 | 450K | |
| bubbles.it | 2011-05-29 12:57 | 448K | |
| multiple inheritance.it | 2011-05-29 13:36 | 448K | |
| hydration pod.it | 2011-05-29 13:23 | 445K | |
| cascade resort.it | 2011-05-29 12:58 | 445K | |
| boros.it | 2011-05-29 12:56 | 445K | |
| never.it | 2011-05-29 13:37 | 445K | |
| mod.it | 2011-05-29 13:35 | 443K | |
| amen temple.it | 2011-05-29 12:48 | 443K | |
| biscuit world.it | 2011-05-29 12:53 | 442K | |
| copies.it | 2011-05-29 13:03 | 440K | |
| facility is denied.it | 2011-05-29 13:14 | 440K | |
| speedball.it | 2011-05-29 13:58 | 440K | |
| soupchair.it | 2011-05-29 13:57 | 438K | |
| yoshi salad.it | 2011-05-29 14:13 | 436K | |
| homper.it | 2018-01-02 16:00 | 434K | |
| scary dean forest.it | 2011-05-29 13:49 | 430K | |
| lexicon.it | 2011-05-29 13:29 | 430K | |
| dingo wrestling.it | 2011-05-29 13:07 | 430K | |
| madventures in harmony.it | 2011-05-29 13:31 | 429K | |
| yuuuu.it | 2011-05-29 14:15 | 428K | |
| mallow crusader.it | 2011-05-29 13:32 | 428K | |
| spacemitts.it | 2011-05-29 13:58 | 428K | |
| nike hair.it | 2011-05-29 13:38 | 427K | |
| spiner.it | 2018-01-02 16:01 | 425K | |
| duck party.it | 2011-05-29 13:11 | 424K | |
| lemonchester.it | 2011-05-29 13:29 | 423K | |
| ao.it | 2011-05-29 12:49 | 421K | |
| hard techno.it | 2011-05-29 13:21 | 417K | |
| breakfast lunch.it | 2011-05-29 12:56 | 417K | |
| hershey highway.it | 2011-05-29 13:22 | 415K | |
| overdog.it | 2011-05-29 13:40 | 414K | |
| inkoddi's farm adventures.it | 2011-05-29 13:25 | 410K | |
| chemical crocodile.it | 2011-05-29 13:00 | 410K | |
| chocolate bleach.it | 2011-05-29 13:00 | 410K | |
| pack it in.it | 2011-05-29 13:41 | 407K | |
| cherry blossom requiem.it | 2011-05-29 13:00 | 407K | |
| filet.it | 2011-05-29 13:16 | 406K | |
| kono kokoro ni.it | 2011-05-29 13:28 | 405K | |
| siege at midnight.it | 2011-05-29 13:53 | 404K | |
| the pies.it | 2018-01-02 16:01 | 404K | |
| incorrect addressing mode.it | 2011-05-29 13:24 | 403K | |
| genie shuffle.it | 2011-05-29 13:19 | 402K | |
| hidden castle.it | 2011-05-29 13:22 | 401K | |
| smacks.it | 2011-05-29 13:55 | 401K | |
| new teeth.it | 2011-05-29 13:37 | 401K | |
| wrapple.it | 2011-05-29 14:12 | 400K | |
| sparky.it | 2011-05-29 13:58 | 400K | |
| phy sings the classics.it | 2011-05-29 13:42 | 398K | |
| flote ilend (karby).it | 2011-05-29 13:17 | 396K | |
| short name.it | 2011-05-29 13:52 | 396K | |
| nexter.it | 2011-05-29 13:37 | 396K | |
| leave reduz alone!@#@-.it | 2018-01-02 16:00 | 394K | |
| resonance chamber.it | 2011-05-29 13:46 | 394K | |
| groovemaster's jazz cafe.it | 2011-05-29 13:21 | 393K | |
| indecision.it | 2011-05-29 13:25 | 392K | |
| wrong style.it | 2011-05-29 14:12 | 392K | |
| logibread.it | 2011-05-29 13:31 | 391K | |
| thrillho.it | 2011-05-29 14:04 | 391K | |
| woke.it | 2018-01-02 16:01 | 390K | |
| dull steam.it | 2011-05-29 13:13 | 388K | |
| true goats.it | 2011-05-29 14:07 | 388K | |
| bonus.it | 2011-05-29 12:55 | 387K | |
| sarama.it | 2018-01-02 16:00 | 387K | |
| close encounter of the 24b.it | 2011-05-29 13:02 | 383K | |
| suisse.it | 2011-05-29 14:00 | 383K | |
| sand dollar.it | 2011-05-29 13:48 | 380K | |
| optimistic wave (optimism).it | 2011-05-29 13:40 | 380K | |
| escape.it | 2011-05-29 13:14 | 375K | |
| butt carver.it | 2011-05-29 12:57 | 374K | |
| mukundlevania.it | 2011-05-29 13:36 | 373K | |
| goblins etc ii.it | 2011-05-29 13:20 | 372K | |
| the n the n the n the n.it | 2011-05-29 14:03 | 372K | |
| salad racer.it | 2011-05-29 13:48 | 370K | |
| milk rocket.it | 2011-05-29 13:34 | 368K | |
| inid.it | 2011-05-29 13:25 | 368K | |
| baconnaise.it | 2011-05-29 12:51 | 367K | |
| temperate zone.it | 2011-05-29 14:02 | 366K | |
| oskari drinks garlic milk.it | 2011-05-29 13:40 | 366K | |
| oerg866's girlfriend.it | 2018-01-02 16:00 | 365K | |
| banana butter.it | 2011-05-29 12:52 | 363K | |
| chenzyme.it | 2018-01-02 16:00 | 363K | |
| manifest.it | 2011-05-29 13:33 | 363K | |
| quainor.it | 2011-05-29 13:44 | 362K | |
| kwakfest11.it | 2018-01-02 16:00 | 361K | |
| blockfarty.it | 2011-05-29 12:55 | 360K | |
| crumb behavior.it | 2011-05-29 13:04 | 360K | |
| jc dental.it | 2018-01-02 16:00 | 360K | |
| unintelligent duck music.it | 2011-05-29 14:08 | 359K | |
| dire sloth zone.it | 2011-05-29 13:07 | 358K | |
| squirrel trigger.it | 2011-05-29 13:59 | 358K | |
| qed.it | 2011-05-29 13:44 | 358K | |
| the fury of deven gallo.it | 2011-05-29 14:03 | 356K | |
| mazda.it | 2011-05-29 13:33 | 355K | |
| today is not sunday.it | 2011-05-29 14:05 | 355K | |
| wapiko genkiyoho.it | 2011-05-29 14:09 | 354K | |
| fallout.it | 2011-05-29 13:15 | 352K | |
| faerosol.it | 2018-01-02 16:00 | 352K | |
| sinesep.it | 2018-01-02 16:01 | 351K | |
| conserved.it | 2011-05-29 13:03 | 350K | |
| jupiter.voyage.it | 2011-05-29 13:26 | 350K | |
| asphalt swamp.it | 2011-05-29 12:50 | 350K | |
| bumber.it | 2018-01-02 16:00 | 350K | |
| madbrain chord school.it | 2011-05-29 13:31 | 349K | |
| confusation.it | 2011-05-29 13:03 | 348K | |
| calcuda.it | 2011-05-29 12:57 | 344K | |
| gone and going.it | 2011-05-29 13:20 | 343K | |
| phony pony.it | 2011-05-29 13:42 | 343K | |
| acid gunner.it | 2011-05-29 12:46 | 341K | |
| dudoodle.it | 2011-05-29 13:13 | 340K | |
| sametypeattackbonus.it | 2011-05-29 13:48 | 339K | |
| curse of the qualosamples.it | 2011-05-29 13:04 | 339K | |
| so so damn tired.it | 2011-05-29 13:57 | 339K | |
| my fried chicken.it | 2011-05-29 13:36 | 338K | |
| sweet waste.it | 2018-01-02 16:01 | 337K | |
| emily.it | 2011-05-29 13:14 | 337K | |
| ham definition.it | 2011-05-29 13:21 | 337K | |
| donk.it | 2011-05-29 13:09 | 337K | |
| goat clock.it | 2011-05-29 13:20 | 335K | |
| side side angle.it | 2011-05-29 13:53 | 332K | |
| bouss.it | 2011-05-29 12:56 | 331K | |
| bismuth.it | 2011-05-29 12:53 | 330K | |
| coda beat gets the job don.it | 2011-05-29 13:02 | 329K | |
| qualo reads penny arcade.it | 2011-05-29 13:44 | 325K | |
| underground lake.it | 2011-05-29 14:08 | 324K | |
| joliet.it | 2018-01-02 16:00 | 324K | |
| gee.it | 2018-01-02 16:00 | 320K | |
| the wizard's library.it | 2011-05-29 14:04 | 320K | |
| chad technology.it | 2011-05-29 12:59 | 318K | |
| doot doo doo.it | 2011-05-29 13:10 | 316K | |
| scrambled sausages.it | 2011-05-29 13:49 | 316K | |
| veiner.it | 2011-05-29 14:09 | 315K | |
| chorizo ruins.it | 2011-05-29 13:01 | 312K | |
| corn flaking.it | 2011-05-29 13:03 | 311K | |
| rubic.it | 2011-05-29 13:47 | 310K | |
| bacorn.it | 2011-05-29 12:51 | 308K | |
| the shrunken rectum.it | 2011-05-29 14:04 | 308K | |
| frogule.it | 2018-01-02 16:00 | 306K | |
| dogforge.it | 2018-01-02 16:00 | 304K | |
| falafel zone.it | 2009-11-01 17:12 | 303K | |
| cheetahmale on male.it | 2011-05-29 13:00 | 301K | |
| touchpad tournesol.it | 2011-05-29 14:06 | 301K | |
| cinnamonroll.it | 2011-05-29 13:01 | 301K | |
| submarobin.it | 2011-05-29 13:59 | 300K | |
| pancakes.it | 2011-05-29 13:41 | 299K | |
| memoire.it | 2011-05-29 13:34 | 299K | |
| flower petal fog.it | 2011-05-29 13:17 | 298K | |
| too tired to name.it | 2011-05-29 14:06 | 297K | |
| yepnope.it | 2018-01-02 16:01 | 297K | |
| alan merkin.it | 2011-05-29 12:47 | 296K | |
| great walls.it | 2011-05-29 13:20 | 296K | |
| soft serve.it | 2011-05-29 13:57 | 294K | |
| bale.it | 2018-01-02 16:00 | 291K | |
| ascelpius.it | 2011-05-29 12:49 | 290K | |
| active spoon.it | 2011-05-29 12:46 | 288K | |
| daizy fields.it | 2011-05-29 13:04 | 288K | |
| caret underscore caret.it | 2011-05-29 12:58 | 288K | |
| blossom.it | 2011-05-29 12:55 | 288K | |
| white tower.it | 2011-05-29 14:11 | 288K | |
| ytrewq.it | 2011-05-29 14:15 | 287K | |
| dirac sea.it | 2011-05-29 13:07 | 286K | |
| huevon.it | 2018-01-02 16:00 | 285K | |
| pux.it | 2011-05-29 13:44 | 285K | |
| a fine duck.it | 2011-05-29 12:46 | 284K | |
| technology science.it | 2011-05-29 14:02 | 283K | |
| atlantis jr.it | 2011-05-29 12:50 | 282K | |
| dizzy is nuts.it | 2011-05-29 13:08 | 280K | |
| aqueduct.it | 2011-05-29 12:49 | 279K | |
| servant.it | 2011-05-29 13:51 | 278K | |
| hello menace.it | 2011-05-29 13:22 | 278K | |
| quartz dust.it | 2011-05-29 13:45 | 277K | |
| argus.it | 2011-05-29 12:49 | 277K | |
| siika.it | 2011-05-29 13:53 | 276K | |
| wontcha rock.it | 2011-05-29 14:11 | 275K | |
| chunk light.it | 2011-05-29 13:01 | 270K | |
| nogghole.it | 2018-01-02 16:00 | 270K | |
| capsaicinoid.it | 2011-05-29 12:58 | 270K | |
| croque-master.it | 2011-05-29 13:04 | 270K | |
| do it again.it | 2011-05-29 13:08 | 269K | |
| xaimus.it | 2011-05-29 14:12 | 269K | |
| bagel pocket.it | 2018-01-02 16:00 | 268K | |
| side story melody.it | 2011-05-29 13:53 | 268K | |
| what i found in the toilet.it | 2011-05-29 14:10 | 268K | |
| advanced burrito tech.it | 2011-05-29 12:47 | 268K | |
| deboner.it | 2011-05-29 13:04 | 267K | |
| clear artery.it | 2011-05-29 13:02 | 266K | |
| wag.it | 2011-05-29 14:09 | 265K | |
| asteroids ) hemmorhoids.it | 2011-05-29 12:50 | 263K | |
| hairy ball theorem (wip).it | 2011-05-29 13:21 | 263K | |
| webfoot team.it | 2018-01-02 16:01 | 263K | |
| bowtie.it | 2011-05-29 12:56 | 263K | |
| my dear phase lead.it | 2011-05-29 13:36 | 263K | |
| moon rabbit.it | 2011-05-29 13:35 | 262K | |
| churro plains.it | 2011-05-29 13:01 | 260K | |
| the nunchuk.it | 2011-05-29 14:03 | 259K | |
| zxcv.it | 2011-05-29 14:15 | 258K | |
| unclean.it | 2018-01-02 16:01 | 257K | |
| nyoro-n.it | 2011-05-29 13:39 | 256K | |
| dog buffer.it | 2011-05-29 13:08 | 256K | |
| woudkart.it | 2018-01-02 16:01 | 256K | |
| duxolydian.it | 2011-05-29 13:13 | 254K | |
| sandcluck.it | 2011-05-29 13:48 | 254K | |
| pocketwatch.it | 2018-01-02 16:00 | 251K | |
| cheeseforest.it | 2011-05-29 13:00 | 250K | |
| dive to ocean floor.it | 2011-05-29 13:08 | 250K | |
| when you're sleeping.it | 2011-05-29 14:11 | 249K | |
| skype.it | 2011-05-29 13:54 | 249K | |
| mole bomb.it | 2011-05-29 13:35 | 248K | |
| bass reflux.it | 2011-05-29 12:52 | 248K | |
| the fallen.it | 2011-05-29 14:02 | 248K | |
| kuukan.it | 2011-05-29 13:28 | 248K | |
| golden frog.it | 2011-05-29 13:20 | 247K | |
| aslsa.it | 2011-05-29 12:49 | 247K | |
| northern polk.it | 2011-05-29 13:39 | 246K | |
| taste the cake.it | 2011-05-29 14:01 | 246K | |
| captain badass.it | 2011-05-29 12:58 | 245K | |
| power wrist.it | 2011-05-29 13:43 | 245K | |
| secret handshake.it | 2018-01-02 16:00 | 243K | |
| mallard magic.it | 2011-05-29 13:32 | 243K | |
| jungle stream.it | 2011-05-29 13:26 | 243K | |
| a nice guy.it | 2011-05-29 12:46 | 241K | |
| destruction of a galaxy.it | 2011-05-29 13:05 | 240K | |
| mayan plumbing.it | 2011-05-29 13:33 | 240K | |
| unknown hacker.it | 2011-05-29 14:08 | 238K | |
| red spider moon.it | 2011-05-29 13:46 | 237K | |
| slim.it | 2018-01-02 16:01 | 236K | |
| bass solo at end.it | 2011-05-29 12:52 | 236K | |
| ohmygod.it | 2011-05-29 13:39 | 236K | |
| awesome pack great shelob.it | 2009-11-01 17:12 | 235K | |
| strawberry town.it | 2011-05-29 13:59 | 235K | |
| monosexual.it | 2011-05-29 13:35 | 234K | |
| loli weather forecast.it | 2011-05-29 13:31 | 234K | |
| antichthones.it | 2011-05-29 12:49 | 233K | |
| dish soap xl.it | 2011-05-29 13:07 | 232K | |
| masters of ms-dos.it | 2011-05-29 13:33 | 231K | |
| b0c or b02.it | 2011-05-29 12:51 | 231K | |
| anomalous panda.it | 2011-05-29 12:49 | 230K | |
| rockpopper.it | 2011-05-29 13:47 | 228K | |
| wry.it | 2011-05-29 14:12 | 228K | |
| hard candy land.it | 2011-05-29 13:21 | 227K | |
| scalloped.it | 2011-05-29 13:49 | 225K | |
| sensitive.it | 2011-05-29 13:51 | 225K | |
| storytime with uncleben.it | 2011-05-29 13:59 | 224K | |
| inside the inkoddi.it | 2011-05-29 13:25 | 224K | |
| bonorkraft.it | 2011-05-29 12:55 | 224K | |
| knob kingdom.it | 2011-05-29 13:28 | 222K | |
| nice weather.it | 2011-05-29 13:38 | 222K | |
| nut feast.it | 2011-05-29 13:39 | 221K | |
| gettin down.it | 2011-05-29 13:19 | 221K | |
| demon army.it | 2011-05-29 13:05 | 221K | |
| moss.it | 2011-05-29 13:35 | 221K | |
| tertiary fossil.it | 2011-04-03 12:40 | 220K | |
| not a space song.it | 2011-05-29 13:39 | 220K | |
| lastbowl.it | 2018-01-02 16:00 | 219K | |
| antibird.it | 2011-05-29 12:49 | 219K | |
| aquatic microorganisms.it | 2011-05-29 12:49 | 218K | |
| jumphorse.it | 2018-01-02 16:00 | 217K | |
| duckcream.it | 2011-05-29 13:12 | 217K | |
| sound cube.it | 2011-05-29 13:57 | 217K | |
| aboard the milk truck.it | 2011-05-29 12:46 | 215K | |
| smooth like a fish.it | 2011-05-29 13:55 | 215K | |
| i like them ducks.it | 2009-11-01 17:12 | 214K | |
| inkoddibajs.it | 2011-05-29 13:25 | 214K | |
| gay trance 4 u.it | 2011-05-29 13:19 | 214K | |
| harris village.it | 2011-05-29 13:21 | 214K | |
| smergk.it | 2011-05-29 13:55 | 214K | |
| little umbrella.it | 2011-05-29 13:31 | 213K | |
| the wizard's garden.it | 2011-05-29 14:04 | 213K | |
| hammers.it | 2011-05-29 13:21 | 212K | |
| visitors from another page.it | 2011-05-29 14:09 | 212K | |
| ice facades.it | 2011-05-29 13:24 | 211K | |
| fire.it | 2011-05-29 13:16 | 211K | |
| six pieces of eight.it | 2011-05-29 13:54 | 210K | |
| automathic.it | 2011-05-29 12:50 | 210K | |
| space drink.it | 2011-05-29 13:58 | 209K | |
| danger area.it | 2011-05-29 13:04 | 209K | |
| burrito cluster.it | 2011-05-29 12:57 | 209K | |
| mind pyramid.it | 2011-05-29 13:34 | 209K | |
| a duck's cry.it | 2011-05-29 12:46 | 208K | |
| how does this work.it | 2011-05-29 13:23 | 208K | |
| fufufufufu.it | 2011-05-29 13:17 | 208K | |
| winter window.it | 2011-05-29 14:11 | 206K | |
| what's this due shit.it | 2011-05-29 14:11 | 206K | |
| rahel.it | 2018-01-02 16:00 | 205K | |
| #ff0 spread.it | 2011-05-29 12:44 | 204K | |
| japan shopping adventure.it | 2011-05-29 13:26 | 201K | |
| vote last.it | 2011-05-29 14:09 | 200K | |
| air conditioning.it | 2011-05-29 12:47 | 200K | |
| den.it | 2011-05-29 13:05 | 200K | |
| burp burp.it | 2011-05-29 12:57 | 200K | |
| toothpick tornado.it | 2011-05-29 14:06 | 200K | |
| out of phase.it | 2011-05-29 13:40 | 199K | |
| calcium.it | 2011-05-29 12:57 | 199K | |
| buttsores.it | 2018-01-02 16:00 | 198K | |
| balcon.it | 2011-05-29 12:51 | 198K | |
| vena cava.it | 2011-05-29 14:09 | 198K | |
| buried treasure.it | 2011-05-29 12:57 | 198K | |
| bkotn.it | 2011-05-29 12:54 | 196K | |
| communit.it | 2011-05-29 13:02 | 196K | |
| waaaaaaaaaaaaaaaaaffles.it | 2011-05-29 14:09 | 195K | |
| scratchbacker.it | 2009-11-01 17:12 | 194K | |
| mcmole.it | 2011-05-29 13:33 | 193K | |
| die.it | 2011-05-29 13:06 | 192K | |
| basement.it | 2011-05-29 12:52 | 192K | |
| triangle package.it | 2011-05-29 14:07 | 190K | |
| asserole.it | 2011-05-29 12:50 | 190K | |
| crystarium.it | 2011-05-29 13:04 | 188K | |
| relaxinterval.it | 2011-05-29 13:46 | 188K | |
| my midi baby.it | 2011-05-29 13:36 | 187K | |
| moustacheland.it | 2011-05-29 13:35 | 187K | |
| the secret of rainbow town.it | 2011-05-29 14:04 | 187K | |
| hungrytune.it | 2011-05-29 13:23 | 186K | |
| gnome cave.it | 2011-05-29 13:20 | 186K | |
| minibaggles.it | 2011-05-29 13:34 | 185K | |
| slight return.it | 2011-05-29 13:55 | 184K | |
| saturn.it | 2011-05-29 13:49 | 184K | |
| iced crap.it | 2011-05-29 13:24 | 184K | |
| x5-d50 (goblins etc).it | 2011-05-29 14:12 | 183K | |
| night fog.it | 2011-05-29 13:38 | 183K | |
| mandrasigma makes a drink (food experiment).it | 2011-05-29 13:33 | 183K | |
| nytro.it | 2011-05-29 13:39 | 182K | |
| tetrahedra.it | 2011-05-29 14:02 | 182K | |
| carpool.it | 2011-05-29 12:58 | 181K | |
| songtransfer.it | 2011-05-29 13:57 | 180K | |
| koala milk.it | 2011-05-29 13:28 | 179K | |
| truncate.it | 2011-05-29 14:07 | 178K | |
| gako.it | 2011-05-29 13:18 | 177K | |
| mars burger.it | 2011-05-29 13:33 | 177K | |
| manjam.it | 2011-05-29 13:33 | 177K | |
| isthenics.it | 2011-05-29 13:26 | 176K | |
| computer needs break.it | 2011-05-29 13:03 | 174K | |
| too many bits.it | 2011-05-29 14:06 | 174K | |
| shitshitshit.it | 2011-05-29 13:52 | 173K | |
| created island.it | 2011-05-29 13:04 | 173K | |
| clover.it | 2018-01-02 16:00 | 172K | |
| metrospread.it | 2012-05-13 11:10 | 172K | |
| interlace.it | 2011-05-29 13:26 | 171K | |
| hogdo.it | 2011-05-29 13:23 | 169K | |
| loupe.it | 2011-05-29 13:31 | 169K | |
| ducks in love.it | 2011-05-29 13:12 | 167K | |
| ladyfinger.it | 2018-01-02 16:00 | 167K | |
| mouldy hotdog.it | 2011-05-29 13:35 | 166K | |
| beak.it | 2011-05-29 12:52 | 166K | |
| la casa verde.it | 2011-05-29 13:28 | 166K | |
| quaquaqua.it | 2011-05-29 13:45 | 166K | |
| prog knife.it | 2011-05-29 13:44 | 166K | |
| i hate music.it | 2011-05-29 13:23 | 166K | |
| furniture.it | 2011-05-29 13:17 | 164K | |
| quake against the machine (guerilla).it | 2011-05-29 13:44 | 163K | |
| esophagus.it | 2011-05-29 13:14 | 163K | |
| rabbit cabinet.it | 2011-05-29 13:45 | 161K | |
| moxylvania.it | 2011-05-29 13:35 | 160K | |
| monsquaz zone.it | 2011-05-29 13:35 | 160K | |
| silver spoon.it | 2011-05-29 13:53 | 159K | |
| demanding on the hardware.it | 2011-05-29 13:05 | 158K | |
| forest dennis.it | 2011-05-29 13:17 | 157K | |
| sandman.it | 2011-05-29 13:48 | 156K | |
| silver gardener.it | 2010-06-27 14:41 | 155K | |
| solar sail.it | 2011-05-29 13:57 | 155K | |
| sentacles.it | 2018-01-02 16:00 | 154K | |
| that was an awful pack (pigs).it | 2011-05-29 14:02 | 153K | |
| caliber.it | 2011-05-29 12:57 | 152K | |
| plastic heart.it | 2011-05-29 13:43 | 152K | |
| time stops (toki).it | 2011-05-29 14:05 | 151K | |
| wad.it | 2011-05-29 14:09 | 151K | |
| cove story.it | 2011-05-29 13:03 | 149K | |
| duckdance ii.it | 2011-05-29 13:12 | 149K | |
| mistified.it | 2011-05-29 13:35 | 149K | |
| warm up.it | 2011-05-29 14:10 | 148K | |
| dining with a vampire.it | 2011-05-29 13:07 | 147K | |
| randolph rutherford rorsch.it | 2011-05-29 13:45 | 147K | |
| midget vending machine.it | 2011-05-29 13:34 | 147K | |
| marvelous jellybrush.it | 2011-05-29 13:33 | 147K | |
| smokin stardust.it | 2011-05-29 13:55 | 145K | |
| i want an amiga.it | 2011-05-29 13:24 | 145K | |
| diapason arcoiris-8.it | 2018-01-02 16:00 | 144K | |
| marmalade zone.it | 2011-05-29 13:33 | 142K | |
| the taco runway.it | 2011-05-29 14:04 | 141K | |
| beefcase.it | 2011-05-29 12:53 | 141K | |
| hive.it | 2011-05-29 13:22 | 140K | |
| pastavision.it | 2011-05-29 13:41 | 139K | |
| catacombs.it | 2011-05-29 12:59 | 138K | |
| top 10.it | 2011-05-29 14:06 | 137K | |
| secret bays.it | 2011-05-29 13:50 | 137K | |
| one must fail.it | 2011-05-29 13:39 | 137K | |
| suture.it | 2011-05-29 14:00 | 136K | |
| amigarabbit.it | 2011-05-29 12:48 | 135K | |
| retarded bossa.it | 2011-05-29 13:46 | 134K | |
| lobster race.it | 2011-05-29 13:31 | 133K | |
| beer hall antics.it | 2011-05-29 12:53 | 132K | |
| getchex.it | 2011-05-29 13:19 | 131K | |
| vine.it | 2011-05-29 14:09 | 131K | |
| mark marky.it | 2011-05-29 13:33 | 131K | |
| meow.it | 2011-05-29 13:34 | 130K | |
| another generic song.it | 2011-05-29 12:49 | 130K | |
| software.it | 2011-05-29 13:57 | 130K | |
| rage gear.it | 2011-05-29 13:45 | 128K | |
| chipwang.it | 2011-05-29 13:00 | 128K | |
| butt hat.it | 2011-05-29 12:57 | 126K | |
| one must rage.it | 2011-05-29 13:39 | 125K | |
| lemon light.it | 2011-05-29 13:29 | 125K | |
| samic.it | 2011-05-29 13:48 | 124K | |
| dirty taqueria.it | 2011-05-29 13:07 | 123K | |
| striped.it | 2011-05-29 13:59 | 122K | |
| you brasstards.it | 2011-05-29 14:13 | 121K | |
| dream bouillon.it | 2011-05-29 13:11 | 121K | |
| sick pepper.it | 2011-05-29 13:53 | 121K | |
| fish magnifier.it | 2011-05-29 13:16 | 120K | |
| kern.ipc.nmbclusters.it | 2011-05-29 13:26 | 120K | |
| little igloo.it | 2011-05-29 13:30 | 120K | |
| santa ana banana.it | 2011-05-29 13:48 | 120K | |
| reduz visits rabbitland.it | 2011-05-29 13:46 | 119K | |
| the gay chords.it | 2011-05-29 14:03 | 119K | |
| reduction in force.it | 2011-05-29 13:46 | 118K | |
| penis weather.it | 2011-05-29 13:42 | 118K | |
| sinus infection.it | 2011-05-29 13:54 | 117K | |
| fell down in a hole.it | 2011-05-29 13:16 | 117K | |
| wormwood.it | 2011-05-29 14:12 | 117K | |
| crescent.it | 2011-05-29 13:04 | 117K | |
| the burpmeister.it | 2011-05-29 14:02 | 116K | |
| bye.it | 2011-05-29 12:57 | 116K | |
| noxious planet.it | 2011-05-29 13:39 | 115K | |
| tricell.it | 2011-05-29 14:07 | 115K | |
| mr. misterface.it | 2011-05-29 13:35 | 115K | |
| bipartite.it | 2011-05-29 12:53 | 114K | |
| canned.it | 2011-05-29 12:58 | 114K | |
| beef.it | 2011-05-29 12:53 | 112K | |
| iglue.it | 2011-05-29 13:24 | 111K | |
| red green.it | 2011-05-29 13:45 | 110K | |
| anal breeze.it | 2011-05-29 12:48 | 109K | |
| darkened waterway.it | 2011-05-29 13:04 | 108K | |
| the meatballs catastrophe.it | 2011-05-29 14:03 | 106K | |
| potato peeler zone.it | 2011-04-03 12:40 | 106K | |
| norora.it | 2018-01-02 16:00 | 104K | |
| crystal stars.it | 2011-05-29 13:04 | 103K | |
| stomp on bugs.it | 2011-05-29 13:59 | 103K | |
| eatman.it | 2018-01-02 16:00 | 103K | |
| acorn soup.it | 2011-05-29 12:46 | 103K | |
| smacken.it | 2011-05-29 13:55 | 102K | |
| oh.it | 2011-05-29 13:39 | 101K | |
| l0l.it | 2011-05-29 13:28 | 100K | |
| adfvbvb (beardrop).it | 2011-05-29 12:46 | 100K | |
| buttboat.it | 2011-05-29 12:57 | 99K | |
| basement of hellcave.it | 2011-05-29 12:52 | 98K | |
| beach in the sky.it | 2009-11-01 17:12 | 98K | |
| uchuu duck.it | 2011-05-29 14:08 | 97K | |
| furd tarts.it | 2011-05-29 13:17 | 97K | |
| rangoon doilies.it | 2010-06-27 14:41 | 97K | |
| out of time.it | 2011-05-29 13:40 | 97K | |
| anisotropic overworld.it | 2011-05-29 12:48 | 96K | |
| doods.it | 2011-05-29 13:09 | 96K | |
| slowpoke 30min.it | 2011-05-29 13:55 | 96K | |
| dongtrax.it | 2011-05-29 13:09 | 95K | |
| mining for melodies.it | 2011-05-29 13:34 | 95K | |
| blarg blarg blarg.it | 2011-05-29 12:54 | 93K | |
| artificial avocado.it | 2011-05-29 12:49 | 91K | |
| chromatic crap #56.it | 2011-05-29 13:01 | 91K | |
| tinkle.it | 2018-01-02 16:01 | 90K | |
| it's pretty easy.it | 2010-09-05 14:02 | 90K | |
| compo kamikaze.it | 2011-05-29 13:02 | 90K | |
| bad credits.it | 2011-05-29 12:51 | 89K | |
| sid-incompatible.it | 2011-05-29 13:53 | 89K | |
| control.it | 2010-06-27 14:41 | 88K | |
| wild skies.it | 2011-05-29 14:11 | 87K | |
| truffle detector.it | 2011-05-29 14:07 | 86K | |
| ost by nobuo uematus.it | 2018-01-02 16:00 | 86K | |
| st-01 satellite.it | 2011-05-29 13:59 | 85K | |
| semiopteryx.it | 2011-05-29 13:50 | 85K | |
| chiptune-wrk.it | 2011-05-29 13:00 | 85K | |
| rusty cabin.it | 2011-05-29 13:48 | 85K | |
| through the atmosphere.it | 2009-11-01 17:12 | 83K | |
| burt.it | 2018-01-02 16:00 | 83K | |
| butt chunk.it | 2011-05-29 12:57 | 81K | |
| technicanally.it | 2011-05-29 14:01 | 81K | |
| dankton tendon.it | 2018-01-02 16:00 | 80K | |
| baldus.it | 2011-05-29 12:51 | 80K | |
| verizon hold music.it | 2011-05-29 14:09 | 79K | |
| acid planes.it | 2011-05-29 12:46 | 79K | |
| nfo.it | 2011-05-29 13:37 | 77K | |
| omeletto.it | 2011-05-29 13:39 | 77K | |
| continue.it | 2011-05-29 13:03 | 77K | |
| shin-ra romance.it | 2011-05-29 13:51 | 76K | |
| trickie.it | 2011-05-29 14:07 | 76K | |
| cumulus stages.it | 2011-05-29 13:04 | 75K | |
| noodle vector.it | 2011-05-29 13:39 | 74K | |
| the love of cheese.it | 2011-05-29 14:03 | 71K | |
| fistful of tea leaves.it | 2011-05-29 13:16 | 70K | |
| surprise sewer.it | 2011-05-29 14:00 | 70K | |
| master chew.it | 2011-05-29 13:33 | 70K | |
| fucking short.it | 2011-05-29 13:17 | 69K | |
| opal.it | 2011-05-29 13:40 | 68K | |
| japani.it | 2011-05-29 13:26 | 68K | |
| smellyalater.it | 2018-01-02 16:01 | 67K | |
| floppy.it | 2011-05-29 13:17 | 67K | |
| skip.it | 2011-05-29 13:54 | 67K | |
| w key.it | 2011-05-29 14:09 | 66K | |
| harpood.it | 2011-05-29 13:21 | 66K | |
| now you see why.it | 2011-05-29 13:39 | 65K | |
| hello mr. seagull.it | 2011-05-29 13:22 | 65K | |
| fejwihg.it | 2018-01-02 16:00 | 65K | |
| pancake house.it | 2011-05-29 13:41 | 65K | |
| cute girl game.it | 2011-05-29 13:04 | 64K | |
| retarded ice cream truck.it | 2011-05-29 13:46 | 63K | |
| beveled tiler.it | 2011-05-29 12:53 | 63K | |
| bitbin ucdemo2.it | 2018-01-02 16:00 | 61K | |
| normal dog.it | 2018-01-02 16:00 | 61K | |
| snark.it | 2011-05-29 13:56 | 60K | |
| yesso's pimp suit.it | 2011-05-29 14:12 | 59K | |
| crabs in the desert.it | 2011-05-29 13:03 | 59K | |
| marble mars.it | 2011-05-29 13:33 | 59K | |
| nostroke.it | 2018-01-02 16:00 | 58K | |
| distractions.it | 2011-05-29 13:08 | 55K | |
| lonely 68020.it | 2011-05-29 13:31 | 55K | |
| piano jellies.it | 2011-05-29 13:42 | 53K | |
| redundant forest gnomes.it | 2011-05-29 13:46 | 53K | |
| wastedtime.it | 2011-05-29 14:10 | 53K | |
| gitaigo.it | 2011-05-29 13:20 | 52K | |
| pattern.it | 2011-05-29 13:41 | 49K | |
| tooshort.it | 2011-05-29 14:06 | 49K | |
| tyre.it | 2011-05-29 14:08 | 49K | |
| emoji.it | 2018-01-02 16:00 | 48K | |
| stomp on bugs ii.it | 2011-05-29 13:59 | 48K | |
| matunnen.it | 2011-05-29 13:33 | 47K | |
| rest at inn.it | 2011-05-29 13:46 | 46K | |
| star bus.it | 2011-05-29 13:59 | 46K | |
| brownworld.it | 2018-01-02 16:00 | 45K | |
| joule.it | 2011-05-29 13:26 | 45K | |
| filters.it | 2011-05-29 13:16 | 45K | |
| uglies.it | 2011-05-29 14:08 | 44K | |
| a shiny turd.it | 2011-05-29 12:46 | 43K | |
| dggs.it | 2018-01-02 16:00 | 43K | |
| not spicy enough.it | 2018-01-02 16:00 | 42K | |
| ol factory.it | 2011-05-29 13:39 | 41K | |
| fortune cooking.it | 2011-05-29 13:17 | 41K | |
| commander king.it | 2011-05-29 13:02 | 41K | |
| scrum.it | 2018-01-02 16:00 | 41K | |
| move it.it | 2009-11-01 17:12 | 41K | |
| mana drain.it | 2011-05-29 13:33 | 39K | |
| vector field.it | 2011-05-29 14:09 | 38K | |
| onepat.it | 2011-05-29 13:39 | 37K | |
| dinosores.it | 2011-05-29 13:07 | 37K | |
| resonance.it | 2011-05-29 13:46 | 37K | |
| sdl.it | 2011-05-29 13:49 | 36K | |
| taco paradox.it | 2011-05-29 14:01 | 34K | |
| jellin.it | 2011-05-29 13:26 | 32K | |
| pomodoro.it | 2011-05-29 13:43 | 32K | |
| chips and salsa.it | 2011-05-29 13:00 | 31K | |
| dustcup.it | 2011-05-29 13:13 | 31K | |
| pollen resurrection.it | 2011-05-29 13:43 | 30K | |
| beef gravy.it | 2011-05-29 12:53 | 29K | |
| afternoon.it | 2011-05-29 12:47 | 28K | |
| ohnoohnoohno.it | 2018-01-02 16:00 | 27K | |
| rosegarden.it | 2011-05-29 13:47 | 27K | |
| infey the tracker.it | 2011-05-29 13:25 | 26K | |
| untripped.it | 2011-05-29 14:08 | 26K | |
| looniepack (reggie).it | 2011-05-29 13:31 | 26K | |
| different picture.it | 2011-05-29 13:06 | 25K | |
| charlie tuna.it | 2011-05-29 12:59 | 21K | |
| bank gothic is a bad font.it | 2011-05-29 12:52 | 21K | |
| discovery.it | 2011-05-29 13:07 | 20K | |
| backbeard.it | 2011-05-29 12:51 | 20K | |
| melodramatech.it | 2011-05-29 13:33 | 15K | |
| the bottleneck factory.it | 2018-01-02 16:01 | 15K | |
| gay stingrays.it | 2011-05-29 13:18 | 15K | |
| animals.it | 2018-01-02 16:00 | 13K | |
| western chips.it | 2011-05-29 14:10 | 13K | |
| run after from bear.it | 2011-05-29 13:47 | 8.3K | |
| softest.it | 2018-01-02 16:01 | 8.0K | |
| stubby.it | 2011-05-29 13:59 | 7.8K | |
| shart.it | 2011-05-29 13:51 | 6.6K | |
| goldilocks.it | 2011-05-29 13:20 | 6.6K | |
| sleepytime for cutebunny.it | 2011-05-29 13:54 | 5.3K | |
| custard pi.it | 2011-05-29 13:04 | 3.9K | |
![[DIR]](/icons/folder.gif) | coop-Xaimus/ | 2011-08-07 13:12 | - | |
|
|---|