![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| husogenic drug.it | 2008-07-04 13:01 | 453K | |
| logic bank.it | 2008-07-04 13:01 | 149K | |
| maussolos tomb.it | 2008-07-04 13:01 | 589K | |
| necropolis.it | 2008-07-04 13:01 | 554K | |
| pyrrhic victory.it | 2008-07-04 13:02 | 422K | |
| the devil wears a dress.it | 2008-07-04 13:02 | 265K | |
| the divine comedy.it | 2008-07-04 13:02 | 160K | |
| the electron groove.it | 2008-07-04 13:02 | 775K | |
| the istar gate.it | 2008-07-04 13:02 | 88K | |
| the prostitute principle.it | 2008-07-04 13:02 | 430K | |
| the temple of artemis.it | 2008-07-04 13:02 | 324K | |