![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | the temple of artemis.it | 2008-07-04 13:02 | 324K | |
| the prostitute principle.it | 2008-07-04 13:02 | 430K | |
| the istar gate.it | 2008-07-04 13:02 | 88K | |
| the electron groove.it | 2008-07-04 13:02 | 775K | |
| the divine comedy.it | 2008-07-04 13:02 | 160K | |
| the devil wears a dress.it | 2008-07-04 13:02 | 265K | |
| pyrrhic victory.it | 2008-07-04 13:02 | 422K | |
| necropolis.it | 2008-07-04 13:01 | 554K | |
| maussolos tomb.it | 2008-07-04 13:01 | 589K | |
| logic bank.it | 2008-07-04 13:01 | 149K | |
| husogenic drug.it | 2008-07-04 13:01 | 453K | |
|
|---|