![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | absence of faith.it | 2008-07-04 16:17 | 1.0M | |
| alley rat.it | 2008-07-04 16:17 | 356K | |
| anemone.it | 2008-07-04 16:17 | 229K | |
| anode layer.it | 2008-07-04 16:17 | 373K | |
| believe.it | 2008-07-04 16:17 | 1.2M | |
| cardiac arrest.it | 2008-07-04 16:17 | 123K | |
| committed.it | 2008-07-04 16:17 | 1.3M | |
| compound eye.it | 2008-07-04 16:17 | 1.0M | |
![[DIR]](/icons/folder.gif) | coop-Kneko/ | 2008-07-04 16:20 | - | |
| coop-RS3/ | 2008-07-04 16:20 | - | |
| coop-Troll/ | 2008-07-04 16:20 | - | |
| darren, goodbye.it | 2008-07-04 16:18 | 1.3M | |
| escaped convict.it | 2008-07-04 16:18 | 1.0M | |
| ether in the mix.it | 2008-07-04 16:18 | 556K | |
| exit.it | 2008-07-04 16:18 | 732K | |
| half edaced.it | 2008-07-04 16:18 | 860K | |
| halloween-murder zero mix.it | 2008-07-04 16:18 | 764K | |
| in a strange light.it | 2008-07-04 16:18 | 1.6M | |
| invidia.it | 2008-07-04 16:18 | 211K | |
| logic bomb.it | 2008-07-04 16:19 | 672K | |
| lullaby for a sinewave.it | 2008-07-04 16:19 | 7.5K | |
| obelisk.it | 2008-07-04 16:19 | 1.4M | |
| octavius low.it | 2008-07-04 16:19 | 1.3M | |
| of a place beyond.it | 2008-07-04 16:19 | 360K | |
| permafrost.it | 2008-07-04 16:19 | 853K | |
| requiem (for raven).it | 2008-07-04 16:19 | 682K | |
| sacrosanct.it | 2008-07-04 16:19 | 1.3M | |
| schedule x.it | 2008-07-04 16:20 | 2.0M | |
| twenty five.it | 2008-07-04 16:20 | 742K | |
| will i dream.it | 2008-07-04 16:20 | 1.0M | |
|
|---|