![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 213 groove st.it | 2008-07-04 21:28 | 396K | |
| a song for my queen.it | 2008-07-04 21:28 | 2.5M | |
| beyond chips.it | 2008-07-04 21:28 | 22K | |
| cartoon sun.it | 2008-07-04 21:28 | 770K | |
| chanting chip-monks.it | 2008-07-04 21:28 | 10K | |
| crapp (cranial racket and pissed off people).it | 2008-07-04 21:29 | 163K | |
| cyberspace dusk.it | 2008-07-04 21:29 | 960K | |
| destination fantascape.it | 2008-07-04 21:29 | 955K | |
| drifting through space.it | 2008-07-04 21:29 | 635K | |
| endless paradise.it | 2008-07-04 21:29 | 342K | |
| falling chips.it | 2008-07-04 21:29 | 13K | |
| floating in a spacesuit.it | 2008-07-04 21:29 | 408K | |
| hello, mr. sun.it | 2008-07-04 21:29 | 754K | |
| hunting the hunters.it | 2008-07-04 21:29 | 1.5M | |
| leaves of daniktu forest.it | 2008-07-04 21:29 | 1.0M | |
| march ofthe harvester ant.it | 2008-07-04 21:29 | 10K | |
| march of the stick figure.it | 2008-07-04 21:29 | 1.0M | |
| mario 64 underwater remix.it | 2008-07-04 21:30 | 402K | |
| moonscape sunrise.it | 2008-07-04 21:30 | 1.4M | |
| morhping space and time.it | 2008-07-04 21:30 | 185K | |
| neural synthesis.it | 2008-07-04 21:30 | 1.0M | |
| nightfall.it | 2008-07-04 21:30 | 225K | |
| orbiting europa.it | 2008-07-04 21:30 | 1.1M | |
| orbiting great distances.it | 2008-07-04 21:30 | 531K | |
| pacman's pulsating nerve.it.it | 2008-07-04 21:30 | 170K | |
| planetary groove.it | 2008-07-04 21:30 | 464K | |
| purple-clouded planetoid.it | 2008-07-04 21:30 | 965K | |
| reaching the sky.it | 2008-07-04 21:30 | 290K | |
| returning to oblivion.it | 2008-07-04 21:30 | 659K | |
| running to find it.it | 2008-07-04 21:31 | 691K | |
| sidewalk gum.it | 2008-07-04 21:31 | 831K | |
| solar waves.it | 2008-07-04 21:31 | 1.1M | |
| starbase 132 come in.it | 2008-07-04 21:31 | 1.0M | |
| starlight starbright.it | 2008-07-04 21:31 | 45K | |
| testflight vega-d.it | 2008-07-04 21:31 | 1.1M | |
| the andy chippith show.it | 2008-07-04 21:31 | 8.6K | |
| the blinding life.it | 2008-07-04 21:31 | 2.0M | |
| the exploding kind.it | 2008-07-04 21:31 | 353K | |
| the flight into your mind.it | 2008-07-04 21:32 | 1.5M | |
| the mysterious forest.it | 2008-07-04 21:32 | 1.1M | |
| the runaway.it | 2008-07-04 21:32 | 1.5M | |
| the universe in 8-bits.it | 2008-07-04 21:32 | 52K | |
| through the ionosphere.it | 2008-07-04 21:32 | 1.4M | |
| uptown at midnight.it | 2008-07-04 21:32 | 882K | |
| utterville.it | 2008-07-04 21:32 | 172K | |
| welcome to oblivion.it | 2008-07-04 21:32 | 804K | |
| well damnit.it | 2008-07-04 21:32 | 353K | |
| whispers in the rain.it | 2008-07-04 21:33 | 1.0M | |
| wilow's town of chips.it | 2008-07-04 21:33 | 12K | |
|
|---|