![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | advanced action movie simulator.psid | 2008-07-05 15:04 | 1.8K | |
![[SND]](/icons/sound2.gif) | covert ops in 2d (funktempo).psid | 2008-07-05 15:04 | 3.3K | |
![[SND]](/icons/sound2.gif) | ex inferis.psid | 2008-07-05 15:04 | 3.0K | |
![[SND]](/icons/sound2.gif) | galwaytest.psid | 2008-07-05 15:04 | 1.7K | |
![[SND]](/icons/sound2.gif) | goat of the woods.psid | 2008-07-05 15:04 | 2.8K | |
![[SND]](/icons/sound2.gif) | illumination.psid | 2008-07-05 15:04 | 4.2K | |
![[SND]](/icons/sound2.gif) | maximum rastertime test.psid | 2008-07-05 15:04 | 1.6K | |
![[SND]](/icons/sound2.gif) | metal warrior 4 (preview).psid | 2008-07-05 15:04 | 6.2K | |
![[DIR]](/icons/folder.gif) | coop-Aeuk/ | 2008-07-05 15:04 | - | |
![[DIR]](/icons/folder.gif) | coop-Crow/ | 2008-07-05 15:04 | - | |
![[SND]](/icons/sound2.gif) | mw4 - agency hq march.psid | 2008-07-05 15:04 | 3.7K | |
![[SND]](/icons/sound2.gif) | mw4 - covert ops in 2d.psid | 2008-07-05 15:04 | 3.3K | |
![[SND]](/icons/sound2.gif) | mw4 - investigations.psid | 2008-07-05 15:04 | 3.6K | |
![[SND]](/icons/sound2.gif) | mw4 - the chosen path.psid | 2008-07-05 15:04 | 3.8K | |
![[SND]](/icons/sound2.gif) | mw title remix, 2x-speed.psid | 2008-07-05 15:04 | 2.4K | |
![[SND]](/icons/sound2.gif) | mw title remix.psid | 2008-07-05 15:04 | 2.4K | |
![[SND]](/icons/sound2.gif) | nintendo-style.psid | 2008-07-05 15:04 | 2.3K | |
![[SND]](/icons/sound2.gif) | on a sanction from cia.psid | 2008-07-05 15:04 | 2.5K | |
![[SND]](/icons/sound2.gif) | road to ruin.psid | 2008-07-05 15:04 | 4.1K | |
![[SND]](/icons/sound2.gif) | soldiers of satan.psid | 2008-07-05 15:04 | 3.5K | |
![[SND]](/icons/sound2.gif) | the consultant.psid | 2008-07-05 15:04 | 1.6K | |
![[SND]](/icons/sound2.gif) | warlord.psid | 2008-07-05 15:04 | 3.7K | |
![[SND]](/icons/sound2.gif) | darkening.psid | 2008-07-08 12:50 | 4.4K | |
![[DIR]](/icons/folder.gif) | coop-Malekith/ | 2009-02-02 15:49 | - | |
![[SND]](/icons/sound2.gif) | shotgate.psid | 2009-02-02 15:49 | 1.0K | |
![[SND]](/icons/sound2.gif) | aces high.psid | 2009-05-02 03:06 | 5.5K | |
![[SND]](/icons/sound2.gif) | airwolf theme.psid | 2009-05-02 03:06 | 1.8K | |
![[SND]](/icons/sound2.gif) | commando.psid | 2009-05-02 03:06 | 1.8K | |
![[SND]](/icons/sound2.gif) | darkness.psid | 2009-05-02 03:06 | 7.5K | |
![[SND]](/icons/sound2.gif) | goattracker drum example.psid | 2009-05-02 03:06 | 1.4K | |
![[SND]](/icons/sound2.gif) | goattracker example (mw1 title).psid | 2009-05-02 03:06 | 2.1K | |
![[SND]](/icons/sound2.gif) | ions 2.psid | 2009-05-02 03:06 | 3.1K | |
![[SND]](/icons/sound2.gif) | metal warrior 3.psid | 2009-05-02 03:06 | 11K | |
![[SND]](/icons/sound2.gif) | metal warrior 4 (goatpack).psid | 2009-05-02 03:06 | 28K | |
![[SND]](/icons/sound2.gif) | metal warrior.psid | 2009-05-02 03:06 | 6.6K | |
![[SND]](/icons/sound2.gif) | metal warrior 4.psid | 2009-05-02 03:06 | 26K | |
![[SND]](/icons/sound2.gif) | metal warrior unused music.psid | 2009-05-02 03:06 | 4.4K | |
![[SND]](/icons/sound2.gif) | metal warrior v2.psid | 2009-05-02 03:06 | 6.9K | |
![[SND]](/icons/sound2.gif) | papillons intro.psid | 2009-05-02 03:06 | 2.0K | |
![[SND]](/icons/sound2.gif) | transylvanian whipping.psid | 2009-05-02 03:06 | 2.7K | |
![[SND]](/icons/sound2.gif) | true oldskool game music.psid | 2009-05-02 03:06 | 2.9K | |
![[SND]](/icons/sound2.gif) | covert ops in 2d.psid | 2018-01-02 16:12 | 3.3K | |
![[SND]](/icons/sound2.gif) | dojo.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | escape from new york.psid | 2018-01-02 16:12 | 1.7K | |
![[SND]](/icons/sound2.gif) | fight the machine.psid | 2018-01-02 16:12 | 2.6K | |
![[SND]](/icons/sound2.gif) | hessian testmusic.psid | 2018-01-02 16:12 | 1.3K | |
![[SND]](/icons/sound2.gif) | simple.psid | 2018-01-02 16:12 | 1.4K | |
![[SND]](/icons/sound2.gif) | sleepwalk.psid | 2018-01-02 16:12 | 3.1K | |
![[SND]](/icons/sound2.gif) | stereotest.psid | 2018-01-02 16:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | tarantula.psid | 2018-01-02 16:12 | 4.0K | |
![[SND]](/icons/sound2.gif) | unleash the fucking fury.psid | 2018-01-02 16:12 | 7.5K | |
![[SND]](/icons/sound2.gif) | victory against tacgnol.psid | 2018-01-02 16:12 | 2.8K | |
![[SND]](/icons/sound2.gif) | goattracker classical example.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | metal warrior 2.psid | 2018-12-09 11:12 | 7.8K | |
![[SND]](/icons/sound2.gif) | nintendo metal.psid | 2018-12-09 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | slither.psid | 2018-12-09 11:12 | 2.1K | |
![[SND]](/icons/sound2.gif) | hessian.psid | 2018-12-16 11:12 | 23K | |
![[SND]](/icons/sound2.gif) | hessian lower city theme.psid | 2018-12-16 11:12 | 2.9K | |
![[SND]](/icons/sound2.gif) | hessian upper city theme.psid | 2018-12-16 11:12 | 3.2K | |
![[SND]](/icons/sound2.gif) | little sentient hatchback vs ....psid | 2018-12-16 11:12 | 3.4K | |
![[SND]](/icons/sound2.gif) | metal warrior title remix.psid | 2018-12-16 11:12 | 2.2K | |
![[SND]](/icons/sound2.gif) | rant #7 example.psid | 2018-12-16 11:12 | 1.0K | |
![[SND]](/icons/sound2.gif) | scrapped, recycled, reincarnated.psid | 2018-12-16 11:12 | 1.9K | |
![[SND]](/icons/sound2.gif) | steel ranger.psid | 2018-12-16 11:12 | 21K | |
![[SND]](/icons/sound2.gif) | intergalactic code of heroes.psid | 2019-08-24 07:22 | 3.1K | |
|