![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| valley of spirits.psid | 2008-07-05 15:11 | 4.6K | |
| triangelis.psid | 2008-07-05 15:11 | 7.5K | |
| tones part ii.psid | 2008-07-05 15:11 | 13K | |
| the flow of existance.psid | 2018-12-16 11:13 | 7.3K | |
| the divine current.psid | 2008-07-05 15:11 | 6.6K | |
| sense of wonder.psid | 2008-07-05 15:11 | 6.5K | |
| romancing the sid.psid | 2018-01-02 16:12 | 2.9K | |
| quasaris.psid | 2008-07-05 15:11 | 4.8K | |
| partial visits.psid | 2008-07-05 15:11 | 7.9K | |
| laserflake.psid | 2008-07-05 15:11 | 7.3K | |
| internal bonding.psid | 2008-07-05 15:11 | 9.3K | |
| innocent reaction.psid | 2008-07-05 15:11 | 5.0K | |
| etheric substance.psid | 2018-12-16 11:13 | 5.3K | |
| energy drive.psid | 2008-07-05 15:11 | 3.5K | |
| energy dive.psid | 2018-12-16 11:13 | 3.5K | |
| crystaldrive.psid | 2008-07-05 15:11 | 6.9K | |
| bluce li.psid | 2008-07-05 15:11 | 3.6K | |
| beyond fluctuation.psid | 2008-07-05 15:11 | 9.4K | |
| beamship.psid | 2008-07-05 15:11 | 4.9K | |