![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| to late to oscilate.mod | 2008-07-06 21:53 | 40K | |
| struttin'.mod | 2008-07-06 21:53 | 128K | |
| spectre of twice.mod | 2008-07-06 21:53 | 62K | |
| sidney.mod | 2008-07-06 21:53 | 52K | |
| saurongame.mod | 2008-07-06 21:53 | 98K | |
| saucy sheets.mod | 2008-07-06 21:53 | 75K | |
| peculiar molecular.mod | 2008-07-06 21:53 | 133K | |
| pampolina.mod | 2008-07-06 21:53 | 93K | |
| lotus.mod | 2008-07-06 21:53 | 319K | |
| i wanna manna.mod | 2008-07-06 21:53 | 51K | |
| is that you.mod | 2008-07-06 21:53 | 76K | |
| intermodula.mod | 2008-07-06 21:53 | 108K | |
| ice coffee.mod | 2008-07-06 21:53 | 131K | |
| hippopotamus.mod | 2008-07-06 21:53 | 75K | |
| her bloody weekend.mod | 2008-07-06 21:53 | 125K | |
| heavypotamus.mod | 2008-07-06 21:53 | 76K | |
| fortyeight.mod | 2008-07-06 21:53 | 51K | |
| finding home.mod | 2008-07-06 21:52 | 163K | |
| deepcoregame3.mod | 2008-07-06 21:52 | 49K | |
| deepcoregame2.mod | 2008-07-06 21:52 | 42K | |
| deepcoregame1.mod | 2008-07-06 21:52 | 58K | |
| coop-Firefox-DLx-ProperDisco/ | 2024-02-03 06:40 | - | |
| consummation.mod | 2008-07-06 21:52 | 102K | |
| complications ii.mod | 2008-07-06 21:52 | 109K | |
| complications.mod | 2008-07-06 21:52 | 69K | |
| coalmine song.mod | 2008-07-06 21:52 | 75K | |
| capacitor.mod | 2008-07-06 21:52 | 75K | |
| buena vista.mod | 2008-07-06 21:52 | 91K | |